C15H24N2O2 — CID 62987901
2-[3-(2-methyl-1,4-oxazepan-4-yl)propoxy]aniline (PubChem CID 62987901) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-[3-(2-methyl-1,4-oxazepan-4-yl)propoxy]aniline.
| Compound Name | 2-[3-(2-methyl-1,4-oxazepan-4-yl)propoxy]aniline |
|---|---|
| PubChem CID | 62987901 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-[3-(2-methyl-1,4-oxazepan-4-yl)propoxy]aniline |
| SMILES | CC1CN(CCCOc2ccccc2N)CCCO1 |
| InChI | InChI=1S/C15H24N2O2/c1-13-12-17(8-4-10-18-13)9-5-11-19-15-7-3-2-6-14(15)16/h2-3,6-7,13H,4-5,8-12,16H2,1H3 |
| InChIKey | QOOMGNAMJIQXOT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|