C20H32N2O3 — CID 99945435
(2S)-2-methyl-4-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,4-oxazepane (PubChem CID 99945435) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S)-2-methyl-4-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,4-oxazepane.
| Compound Name | (2S)-2-methyl-4-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 99945435 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (2S)-2-methyl-4-[[2-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,4-oxazepane |
| SMILES | C[C@H]1CN(Cc2ccccc2OCCCN2CCOCC2)CCCO1 |
| InChI | InChI=1S/C20H32N2O3/c1-18-16-22(9-5-12-24-18)17-19-6-2-3-7-20(19)25-13-4-8-21-10-14-23-15-11-21/h2-3,6-7,18H,4-5,8-17H2,1H3/t18-/m0/s1 |
| InChIKey | YAAUJYGOFWLUGJ-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|