C21H33N3O — CID 77088681
(3aR,6aS)-5-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 77088681) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is (3aR,6aS)-5-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 77088681 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (3aR,6aS)-5-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | c1ccc(OCCCN2CCCCC2)c(CN2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C21H33N3O/c1-4-9-23(10-5-1)11-6-12-25-21-8-3-2-7-18(21)15-24-16-19-13-22-14-20(19)17-24/h2-3,7-8,19-20,22H,1,4-6,9-17H2/t19-,20+ |
| InChIKey | LRWISGWHFYABFE-BGYRXZFFSA-N |
| XLogP | 2.59 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|