C21H32N2O2 — CID 137343050
(1S,5R,6R)-3-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-azabicyclo[3.2.0]heptan-6-ol (PubChem CID 137343050) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (1S,5R,6R)-3-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-azabicyclo[3.2.0]heptan-6-ol.
| Compound Name | (1S,5R,6R)-3-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-azabicyclo[3.2.0]heptan-6-ol |
|---|---|
| PubChem CID | 137343050 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (1S,5R,6R)-3-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-azabicyclo[3.2.0]heptan-6-ol |
| SMILES | O[C@@H]1C[C@@H]2CN(Cc3ccccc3OCCCN3CCCCC3)C[C@@H]21 |
| InChI | InChI=1S/C21H32N2O2/c24-20-13-18-15-23(16-19(18)20)14-17-7-2-3-8-21(17)25-12-6-11-22-9-4-1-5-10-22/h2-3,7-8,18-20,24H,1,4-6,9-16H2/t18-,19+,20-/m1/s1 |
| InChIKey | OWUPGDDJYATANN-HSALFYBXSA-N |
| XLogP | 2.75 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|