C22H33N3O3 — CID 155919057
(1S,5R)-7-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 155919057) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1S,5R)-7-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | (1S,5R)-7-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 155919057 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (1S,5R)-7-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1N[C@@H]2COC[C@H]1CN(Cc1ccccc1OCCCN1CCCCC1)C2 |
| InChI | InChI=1S/C22H33N3O3/c26-22-19-14-25(15-20(23-22)17-27-16-19)13-18-7-2-3-8-21(18)28-12-6-11-24-9-4-1-5-10-24/h2-3,7-8,19-20H,1,4-6,9-17H2,(H,23,26)/t19-,20+/m1/s1 |
| InChIKey | SKXJCJNVGRGJRH-UXHICEINSA-N |
| XLogP | 1.89 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|