C22H33N3O8 — CID 155971785
formic acid;(1S,5R)-7-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 155971785) has the molecular formula C22H33N3O8 and a molecular weight of 467.52 g/mol. Its IUPAC name is formic acid;(1S,5R)-7-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | formic acid;(1S,5R)-7-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 155971785 |
| Molecular Formula | C22H33N3O8 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | formic acid;(1S,5R)-7-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1N[C@@H]2COC[C@H]1CN(Cc1ccc(OCCN3CCOCC3)cc1)C2.O=CO.O=CO |
| InChI | InChI=1S/C20H29N3O4.2CH2O2/c24-20-17-12-23(13-18(21-20)15-26-14-17)11-16-1-3-19(4-2-16)27-10-7-22-5-8-25-9-6-22;2*2-1-3/h1-4,17-18H,5-15H2,(H,21,24);2*1H,(H,2,3)/t17-,18+;;/m1../s1 |
| InChIKey | RGSBFOMMZCGYKN-WCRQIBMVSA-N |
| XLogP | -0.25 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|