C18H26N2O5 — CID 155972462
formic acid;(1S,5R)-7-(3-phenylmethoxypropyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 155972462) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is formic acid;(1S,5R)-7-(3-phenylmethoxypropyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | formic acid;(1S,5R)-7-(3-phenylmethoxypropyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 155972462 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | formic acid;(1S,5R)-7-(3-phenylmethoxypropyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1N[C@@H]2COC[C@H]1CN(CCCOCc1ccccc1)C2.O=CO |
| InChI | InChI=1S/C17H24N2O3.CH2O2/c20-17-15-9-19(10-16(18-17)13-22-12-15)7-4-8-21-11-14-5-2-1-3-6-14;2-1-3/h1-3,5-6,15-16H,4,7-13H2,(H,18,20);1H,(H,2,3)/t15-,16+;/m1./s1 |
| InChIKey | FFQCEEOCNGSJJL-RCPFAERMSA-N |
| XLogP | 0.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|