C19H28N2O4 — CID 154913094
formic acid;(1S,5R)-3-(3-phenylmethoxypropyl)-3,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 154913094) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is formic acid;(1S,5R)-3-(3-phenylmethoxypropyl)-3,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | formic acid;(1S,5R)-3-(3-phenylmethoxypropyl)-3,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 154913094 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | formic acid;(1S,5R)-3-(3-phenylmethoxypropyl)-3,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1N[C@H]2CCC[C@@H]1CN(CCCOCc1ccccc1)C2.O=CO |
| InChI | InChI=1S/C18H26N2O2.CH2O2/c21-18-16-8-4-9-17(19-18)13-20(12-16)10-5-11-22-14-15-6-2-1-3-7-15;2-1-3/h1-3,6-7,16-17H,4-5,8-14H2,(H,19,21);1H,(H,2,3)/t16-,17+;/m1./s1 |
| InChIKey | SILXPOSYNDAWKE-PPPUBMIESA-N |
| XLogP | 1.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|