C9H20N2O — CID 62987056
3-(2-methyl-1,4-oxazepan-4-yl)propan-1-amine (PubChem CID 62987056) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-(2-methyl-1,4-oxazepan-4-yl)propan-1-amine.
| Compound Name | 3-(2-methyl-1,4-oxazepan-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 62987056 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 3-(2-methyl-1,4-oxazepan-4-yl)propan-1-amine |
| SMILES | CC1CN(CCCN)CCCO1 |
| InChI | InChI=1S/C9H20N2O/c1-9-8-11(5-2-4-10)6-3-7-12-9/h9H,2-8,10H2,1H3 |
| InChIKey | YKELQXIWZFQQQS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |