C10H21N3O2 — CID 63583172
4-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide (PubChem CID 63583172) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide.
| Compound Name | 4-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide |
|---|---|
| PubChem CID | 63583172 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 4-(2-methyl-1,4-oxazepan-4-yl)butanehydrazide |
| SMILES | CC1CN(CCCC(=O)NN)CCCO1 |
| InChI | InChI=1S/C10H21N3O2/c1-9-8-13(6-3-7-15-9)5-2-4-10(14)12-11/h9H,2-8,11H2,1H3,(H,12,14) |
| InChIKey | PIWHZTPAZZWDKL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|