C12H26N2O2 — CID 63070656
2-ethoxy-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-amine (PubChem CID 63070656) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethoxy-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-amine.
| Compound Name | 2-ethoxy-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 63070656 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-ethoxy-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-amine |
| SMILES | CCOC(CN)CCN1CCCOC(C)C1 |
| InChI | InChI=1S/C12H26N2O2/c1-3-15-12(9-13)5-7-14-6-4-8-16-11(2)10-14/h11-12H,3-10,13H2,1-2H3 |
| InChIKey | ZLEXCOIBYDDHIL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |