C16H25NO3S — CID 56789133
4-[3-(2,6-dimethylphenoxy)propyl]-1,4-thiazepane 1,1-dioxide (PubChem CID 56789133) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 4-[3-(2,6-dimethylphenoxy)propyl]-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-[3-(2,6-dimethylphenoxy)propyl]-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 56789133 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[3-(2,6-dimethylphenoxy)propyl]-1,4-thiazepane 1,1-dioxide |
| SMILES | Cc1cccc(C)c1OCCCN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H25NO3S/c1-14-6-3-7-15(2)16(14)20-11-4-8-17-9-5-12-21(18,19)13-10-17/h3,6-7H,4-5,8-13H2,1-2H3 |
| InChIKey | FHPXBGBQWZFXGD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|