C15H25ClN2O — CID 120965850
1-[2-(2,6-dimethylphenoxy)ethyl]piperidin-4-amine;hydrochloride (PubChem CID 120965850) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylphenoxy)ethyl]piperidin-4-amine;hydrochloride.
| Compound Name | 1-[2-(2,6-dimethylphenoxy)ethyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120965850 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 1-[2-(2,6-dimethylphenoxy)ethyl]piperidin-4-amine;hydrochloride |
| SMILES | Cc1cccc(C)c1OCCN1CCC(N)CC1.Cl |
| InChI | InChI=1S/C15H24N2O.ClH/c1-12-4-3-5-13(2)15(12)18-11-10-17-8-6-14(16)7-9-17;/h3-5,14H,6-11,16H2,1-2H3;1H |
| InChIKey | HWRHTKFDIDHBDA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |