C19H31NO — CID 2304722
1-[6-(2,6-dimethylphenoxy)hexyl]piperidine (PubChem CID 2304722) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-[6-(2,6-dimethylphenoxy)hexyl]piperidine.
| Compound Name | 1-[6-(2,6-dimethylphenoxy)hexyl]piperidine |
|---|---|
| PubChem CID | 2304722 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-[6-(2,6-dimethylphenoxy)hexyl]piperidine |
| SMILES | Cc1cccc(C)c1OCCCCCCN1CCCCC1 |
| InChI | InChI=1S/C19H31NO/c1-17-11-10-12-18(2)19(17)21-16-9-4-3-6-13-20-14-7-5-8-15-20/h10-12H,3-9,13-16H2,1-2H3 |
| InChIKey | AJDLUIFQPDZQKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|