2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid

C14H19NO5S — CID 63068279

IUPAC2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCCCN1CCS(=O)(=O)CC1
InChIInChI=1S/C14H19NO5S/c16-14(17)12-4-1-2-5-13(12)20-9-3-6-15-7-10-21(18,19)11-8-15/h1-2,4-5H,3,6-11H2,(H,16,17)
InChIKeyCXBLFHXQYMBYTB-UHFFFAOYSA-N
MW313.37 g/mol
LogP0.88
Rot. Bonds6

About 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid

2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid (PubChem CID 63068279) has the molecular formula C14H19NO5S and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid.

Molecular Properties

Compound Name2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid
PubChem CID63068279
Molecular FormulaC14H19NO5S
Molecular Weight313.37 g/mol
Exact Mass313.10
IUPAC Name2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCCCN1CCS(=O)(=O)CC1
InChIInChI=1S/C14H19NO5S/c16-14(17)12-4-1-2-5-13(12)20-9-3-6-15-7-10-21(18,19)11-8-15/h1-2,4-5H,3,6-11H2,(H,16,17)
InChIKeyCXBLFHXQYMBYTB-UHFFFAOYSA-N
XLogP0.88
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.37
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid?
The IUPAC name of 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid (CID 63068279) is 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid.
What is the SMILES notation for 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid?
The canonical SMILES for 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid is O=C(O)c1ccccc1OCCCN1CCS(=O)(=O)CC1.
What is the InChIKey of 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid?
The InChIKey is CXBLFHXQYMBYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO5S/c16-14(17)12-4-1-2-5-13(12)20-9-3-6-15-7-10-21(18,19)11-8-15/h1-2,4-5H,3,6-11H2,(H,16,17).
What are the key properties of 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid?
2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid has a molecular weight of 313.37 g/mol, XLogP of 0.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propoxy]benzoic acid is sourced from PubChem (CID 63068279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).