C12H14FN3O3S — CID 103003957
3-fluoro-4-[2-(1-methylpyrazol-4-yl)ethoxy]benzenesulfonamide (PubChem CID 103003957) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-fluoro-4-[2-(1-methylpyrazol-4-yl)ethoxy]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-(1-methylpyrazol-4-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 103003957 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-fluoro-4-[2-(1-methylpyrazol-4-yl)ethoxy]benzenesulfonamide |
| SMILES | Cn1cc(CCOc2ccc(S(N)(=O)=O)cc2F)cn1 |
| InChI | InChI=1S/C12H14FN3O3S/c1-16-8-9(7-15-16)4-5-19-12-3-2-10(6-11(12)13)20(14,17)18/h2-3,6-8H,4-5H2,1H3,(H2,14,17,18) |
| InChIKey | WPFDGJOCVJCAFY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |