C10H16N2O4S — CID 82900278
4-amino-3-(2-ethoxyethoxy)benzenesulfonamide (PubChem CID 82900278) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-amino-3-(2-ethoxyethoxy)benzenesulfonamide.
| Compound Name | 4-amino-3-(2-ethoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82900278 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-amino-3-(2-ethoxyethoxy)benzenesulfonamide |
| SMILES | CCOCCOc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C10H16N2O4S/c1-2-15-5-6-16-10-7-8(17(12,13)14)3-4-9(10)11/h3-4,7H,2,5-6,11H2,1H3,(H2,12,13,14) |
| InChIKey | FITDMOJGPDAZDR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|