C12H20N2O4S — CID 43341134
3-amino-4-(2-ethoxyethoxy)-N,N-dimethylbenzenesulfonamide (PubChem CID 43341134) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-amino-4-(2-ethoxyethoxy)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-4-(2-ethoxyethoxy)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43341134 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-amino-4-(2-ethoxyethoxy)-N,N-dimethylbenzenesulfonamide |
| SMILES | CCOCCOc1ccc(S(=O)(=O)N(C)C)cc1N |
| InChI | InChI=1S/C12H20N2O4S/c1-4-17-7-8-18-12-6-5-10(9-11(12)13)19(15,16)14(2)3/h5-6,9H,4,7-8,13H2,1-3H3 |
| InChIKey | HHUKUQXEAISHST-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|