C12H20N2O4S — CID 112587096
4-amino-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonamide (PubChem CID 112587096) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-amino-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonamide.
| Compound Name | 4-amino-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 112587096 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-amino-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]benzenesulfonamide |
| SMILES | CC(C)(C)OCCOc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C12H20N2O4S/c1-12(2,3)18-7-6-17-11-8-9(19(14,15)16)4-5-10(11)13/h4-5,8H,6-7,13H2,1-3H3,(H2,14,15,16) |
| InChIKey | BANJUNICNGUKAE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|