C11H17NO3S — CID 43164510
4-butoxy-3-methylbenzenesulfonamide (PubChem CID 43164510) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-butoxy-3-methylbenzenesulfonamide.
| Compound Name | 4-butoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43164510 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-butoxy-3-methylbenzenesulfonamide |
| SMILES | CCCCOc1ccc(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C11H17NO3S/c1-3-4-7-15-11-6-5-10(8-9(11)2)16(12,13)14/h5-6,8H,3-4,7H2,1-2H3,(H2,12,13,14) |
| InChIKey | XZWVAHZDHMDSDV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|