C13H19NO3S — CID 61344661
4-(cyclopentylmethoxy)-3-methylbenzenesulfonamide (PubChem CID 61344661) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-(cyclopentylmethoxy)-3-methylbenzenesulfonamide.
| Compound Name | 4-(cyclopentylmethoxy)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61344661 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-(cyclopentylmethoxy)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1OCC1CCCC1 |
| InChI | InChI=1S/C13H19NO3S/c1-10-8-12(18(14,15)16)6-7-13(10)17-9-11-4-2-3-5-11/h6-8,11H,2-5,9H2,1H3,(H2,14,15,16) |
| InChIKey | QESUTPSEJCHWIT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |