C15H22N2O6S — CID 110164108
N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(2-methyl-4-sulfamoylphenoxy)acetamide (PubChem CID 110164108) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(2-methyl-4-sulfamoylphenoxy)acetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(2-methyl-4-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 110164108 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-(2-methyl-4-sulfamoylphenoxy)acetamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1OCC(=O)N[C@@H]1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N2O6S/c1-9-7-10(24(16,21)22)5-6-13(9)23-8-14(19)17-11-3-2-4-12(18)15(11)20/h5-7,11-12,15,18,20H,2-4,8H2,1H3,(H,17,19)(H2,16,21,22)/t11-,12-,15-/m1/s1 |
| InChIKey | IVABCVONVYRVCN-LALPHHSUSA-N |
| XLogP | -0.59 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |