C14H19NO4 — CID 110164138
N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-phenoxyacetamide (PubChem CID 110164138) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-phenoxyacetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 110164138 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dihydroxycyclohexyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)N[C@@H]1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO4/c16-12-8-4-7-11(14(12)18)15-13(17)9-19-10-5-2-1-3-6-10/h1-3,5-6,11-12,14,16,18H,4,7-9H2,(H,15,17)/t11-,12-,14-/m1/s1 |
| InChIKey | YISKODOOUUCYAF-YRGRVCCFSA-N |
| XLogP | 0.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |