C15H20N2O4 — CID 110158776
N-[2-[[(1R,2R,3R)-2,3-dihydroxycyclohexyl]amino]-2-oxoethyl]benzamide (PubChem CID 110158776) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[2-[[(1R,2R,3R)-2,3-dihydroxycyclohexyl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[[(1R,2R,3R)-2,3-dihydroxycyclohexyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110158776 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[2-[[(1R,2R,3R)-2,3-dihydroxycyclohexyl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)N[C@@H]1CCC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H20N2O4/c18-12-8-4-7-11(14(12)20)17-13(19)9-16-15(21)10-5-2-1-3-6-10/h1-3,5-6,11-12,14,18,20H,4,7-9H2,(H,16,21)(H,17,19)/t11-,12-,14-/m1/s1 |
| InChIKey | KGZGVZPFKQKELN-YRGRVCCFSA-N |
| XLogP | -0.19 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |