C14H17BrN2O3 — CID 86796998
4-bromo-N-[2-[(2-hydroxycyclopentyl)amino]-2-oxoethyl]benzamide (PubChem CID 86796998) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 4-bromo-N-[2-[(2-hydroxycyclopentyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[(2-hydroxycyclopentyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 86796998 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-bromo-N-[2-[(2-hydroxycyclopentyl)amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)NC1CCCC1O |
| InChI | InChI=1S/C14H17BrN2O3/c15-10-6-4-9(5-7-10)14(20)16-8-13(19)17-11-2-1-3-12(11)18/h4-7,11-12,18H,1-3,8H2,(H,16,20)(H,17,19) |
| InChIKey | OIXMPKOPOZQMFK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |