C14H19NO4 — CID 57331884
benzyl N-[(1S,2S,3S)-2,3-dihydroxycyclohexyl]carbamate (PubChem CID 57331884) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl N-[(1S,2S,3S)-2,3-dihydroxycyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,2S,3S)-2,3-dihydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 57331884 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | benzyl N-[(1S,2S,3S)-2,3-dihydroxycyclohexyl]carbamate |
| SMILES | O=C(N[C@H]1CCC[C@H](O)[C@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO4/c16-12-8-4-7-11(13(12)17)15-14(18)19-9-10-5-2-1-3-6-10/h1-3,5-6,11-13,16-17H,4,7-9H2,(H,15,18)/t11-,12-,13-/m0/s1 |
| InChIKey | VOEKAYMXKUJVKK-AVGNSLFASA-N |
| XLogP | 1.19 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |