C20H23NO2Se — CID 10834125
benzyl N-[(1R,2S)-2-phenylselanylcyclohexyl]carbamate (PubChem CID 10834125) has the molecular formula C20H23NO2Se and a molecular weight of 388.37 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-2-phenylselanylcyclohexyl]carbamate.
| Compound Name | benzyl N-[(1R,2S)-2-phenylselanylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 10834125 |
| Molecular Formula | C20H23NO2Se |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | benzyl N-[(1R,2S)-2-phenylselanylcyclohexyl]carbamate |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1[Se]c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO2Se/c22-20(23-15-16-9-3-1-4-10-16)21-18-13-7-8-14-19(18)24-17-11-5-2-6-12-17/h1-6,9-12,18-19H,7-8,13-15H2,(H,21,22)/t18-,19+/m1/s1 |
| InChIKey | ZLYADOTYNVWZPZ-MOPGFXCFSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|