C16H22N2O6 — CID 91810202
benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid (PubChem CID 91810202) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid.
| Compound Name | benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid |
|---|---|
| PubChem CID | 91810202 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid |
| SMILES | N[C@@H]1CCCC[C@@H]1NC(=O)OCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H20N2O2.C2H2O4/c15-12-8-4-5-9-13(12)16-14(17)18-10-11-6-2-1-3-7-11;3-1(4)2(5)6/h1-3,6-7,12-13H,4-5,8-10,15H2,(H,16,17);(H,3,4)(H,5,6)/t12-,13+;/m1./s1 |
| InChIKey | ZHJNSNPCGGDJPE-KZCZEQIWSA-N |
| XLogP | 1.34 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|