benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid

C16H22N2O6 — CID 91810202

IUPACbenzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid
SMILESN[C@@H]1CCCC[C@@H]1NC(=O)OCc1ccccc1.O=C(O)C(=O)O
InChIInChI=1S/C14H20N2O2.C2H2O4/c15-12-8-4-5-9-13(12)16-14(17)18-10-11-6-2-1-3-7-11;3-1(4)2(5)6/h1-3,6-7,12-13H,4-5,8-10,15H2,(H,16,17);(H,3,4)(H,5,6)/t12-,13+;/m1./s1
InChIKeyZHJNSNPCGGDJPE-KZCZEQIWSA-N
MW338.36 g/mol
LogP1.34
Rot. Bonds3

About benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid

benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid (PubChem CID 91810202) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid.

Molecular Properties

Compound Namebenzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid
PubChem CID91810202
Molecular FormulaC16H22N2O6
Molecular Weight338.36 g/mol
Exact Mass338.15
IUPAC Namebenzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid
SMILESN[C@@H]1CCCC[C@@H]1NC(=O)OCc1ccccc1.O=C(O)C(=O)O
InChIInChI=1S/C14H20N2O2.C2H2O4/c15-12-8-4-5-9-13(12)16-14(17)18-10-11-6-2-1-3-7-11;3-1(4)2(5)6/h1-3,6-7,12-13H,4-5,8-10,15H2,(H,16,17);(H,3,4)(H,5,6)/t12-,13+;/m1./s1
InChIKeyZHJNSNPCGGDJPE-KZCZEQIWSA-N
XLogP1.34
TPSA138.95 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.36
LogP ≤ 51.34
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid?
The IUPAC name of benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid (CID 91810202) is benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid.
What is the SMILES notation for benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid?
The canonical SMILES for benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid is N[C@@H]1CCCC[C@@H]1NC(=O)OCc1ccccc1.O=C(O)C(=O)O.
What is the InChIKey of benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid?
The InChIKey is ZHJNSNPCGGDJPE-KZCZEQIWSA-N. The full InChI is InChI=1S/C14H20N2O2.C2H2O4/c15-12-8-4-5-9-13(12)16-14(17)18-10-11-6-2-1-3-7-11;3-1(4)2(5)6/h1-3,6-7,12-13H,4-5,8-10,15H2,(H,16,17);(H,3,4)(H,5,6)/t12-,13+;/m1./s1.
What are the key properties of benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid?
benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid has a molecular weight of 338.36 g/mol, XLogP of 1.34, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(1S,2R)-2-aminocyclohexyl]carbamate;oxalic acid is sourced from PubChem (CID 91810202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).