C13H19N3O2 — CID 118048951
benzyl N-[(3S,4R)-3-aminopiperidin-4-yl]carbamate (PubChem CID 118048951) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is benzyl N-[(3S,4R)-3-aminopiperidin-4-yl]carbamate.
| Compound Name | benzyl N-[(3S,4R)-3-aminopiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118048951 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | benzyl N-[(3S,4R)-3-aminopiperidin-4-yl]carbamate |
| SMILES | N[C@H]1CNCC[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H19N3O2/c14-11-8-15-7-6-12(11)16-13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9,14H2,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | UFSGHDDAKHRSBK-NWDGAFQWSA-N |
| XLogP | 0.60 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |