C12H15FN2O2 — CID 91757646
benzyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate (PubChem CID 91757646) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is benzyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91757646 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | benzyl N-[(3S,4S)-4-fluoropyrrolidin-3-yl]carbamate |
| SMILES | O=C(N[C@H]1CNC[C@@H]1F)OCc1ccccc1 |
| InChI | InChI=1S/C12H15FN2O2/c13-10-6-14-7-11(10)15-12(16)17-8-9-4-2-1-3-5-9/h1-5,10-11,14H,6-8H2,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | KZWUUEWPRQZDNF-QWRGUYRKSA-N |
| XLogP | 1.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |