C13H17FN2O2 — CID 131116805
benzyl N-[[(3S,4S)-4-fluoropyrrolidin-3-yl]methyl]carbamate (PubChem CID 131116805) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is benzyl N-[[(3S,4S)-4-fluoropyrrolidin-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(3S,4S)-4-fluoropyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 131116805 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | benzyl N-[[(3S,4S)-4-fluoropyrrolidin-3-yl]methyl]carbamate |
| SMILES | O=C(NC[C@@H]1CNC[C@H]1F)OCc1ccccc1 |
| InChI | InChI=1S/C13H17FN2O2/c14-12-8-15-6-11(12)7-16-13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9H2,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | WROJCYXFVZVRRK-NWDGAFQWSA-N |
| XLogP | 1.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |