C14H18F2N2O2 — CID 124671693
benzyl N-[[(3R)-4,4-difluoropiperidin-3-yl]methyl]carbamate (PubChem CID 124671693) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is benzyl N-[[(3R)-4,4-difluoropiperidin-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(3R)-4,4-difluoropiperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 124671693 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | benzyl N-[[(3R)-4,4-difluoropiperidin-3-yl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1CNCCC1(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C14H18F2N2O2/c15-14(16)6-7-17-8-12(14)9-18-13(19)20-10-11-4-2-1-3-5-11/h1-5,12,17H,6-10H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | SCUHCCDILGOUOM-GFCCVEGCSA-N |
| XLogP | 2.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |