C13H17N3O3 — CID 91332106
benzyl N-[[(3R)-4-nitrosopyrrolidin-3-yl]methyl]carbamate (PubChem CID 91332106) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is benzyl N-[[(3R)-4-nitrosopyrrolidin-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(3R)-4-nitrosopyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 91332106 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | benzyl N-[[(3R)-4-nitrosopyrrolidin-3-yl]methyl]carbamate |
| SMILES | O=NC1CNC[C@@H]1CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17N3O3/c17-13(19-9-10-4-2-1-3-5-10)15-7-11-6-14-8-12(11)16-18/h1-5,11-12,14H,6-9H2,(H,15,17)/t11-,12?/m1/s1 |
| InChIKey | LDBGOBPKBNKLHM-JHJMLUEUSA-N |
| XLogP | 1.27 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |