C15H22N2O2 — CID 125117304
benzyl N-[[(2R,5S)-5-methylpiperidin-2-yl]methyl]carbamate (PubChem CID 125117304) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is benzyl N-[[(2R,5S)-5-methylpiperidin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2R,5S)-5-methylpiperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 125117304 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | benzyl N-[[(2R,5S)-5-methylpiperidin-2-yl]methyl]carbamate |
| SMILES | C[C@H]1CC[C@H](CNC(=O)OCc2ccccc2)NC1 |
| InChI | InChI=1S/C15H22N2O2/c1-12-7-8-14(16-9-12)10-17-15(18)19-11-13-5-3-2-4-6-13/h2-6,12,14,16H,7-11H2,1H3,(H,17,18)/t12-,14+/m0/s1 |
| InChIKey | XLEVDWOUHGBDKF-GXTWGEPZSA-N |
| XLogP | 2.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |