C16H17N3O2 — CID 118512746
benzyl N-[(2-pyrimidin-5-ylcyclopropyl)methyl]carbamate (PubChem CID 118512746) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is benzyl N-[(2-pyrimidin-5-ylcyclopropyl)methyl]carbamate.
| Compound Name | benzyl N-[(2-pyrimidin-5-ylcyclopropyl)methyl]carbamate |
|---|---|
| PubChem CID | 118512746 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | benzyl N-[(2-pyrimidin-5-ylcyclopropyl)methyl]carbamate |
| SMILES | O=C(NCC1CC1c1cncnc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H17N3O2/c20-16(21-10-12-4-2-1-3-5-12)19-9-13-6-15(13)14-7-17-11-18-8-14/h1-5,7-8,11,13,15H,6,9-10H2,(H,19,20) |
| InChIKey | BEOIYXPWNLWSIL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |