C18H18FNO2 — CID 90226069
benzyl N-[[(1S,2S)-2-(2-fluorophenyl)cyclopropyl]methyl]carbamate (PubChem CID 90226069) has the molecular formula C18H18FNO2 and a molecular weight of 299.34 g/mol. Its IUPAC name is benzyl N-[[(1S,2S)-2-(2-fluorophenyl)cyclopropyl]methyl]carbamate.
| Compound Name | benzyl N-[[(1S,2S)-2-(2-fluorophenyl)cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 90226069 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | benzyl N-[[(1S,2S)-2-(2-fluorophenyl)cyclopropyl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1C[C@@H]1c1ccccc1F)OCc1ccccc1 |
| InChI | InChI=1S/C18H18FNO2/c19-17-9-5-4-8-15(17)16-10-14(16)11-20-18(21)22-12-13-6-2-1-3-7-13/h1-9,14,16H,10-12H2,(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | CNABWDXSRLRHAV-ZBFHGGJFSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |