C15H19F3N2O2 — CID 124634254
benzyl N-[[(3S,4S)-3-(trifluoromethyl)piperidin-4-yl]methyl]carbamate (PubChem CID 124634254) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is benzyl N-[[(3S,4S)-3-(trifluoromethyl)piperidin-4-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(3S,4S)-3-(trifluoromethyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 124634254 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | benzyl N-[[(3S,4S)-3-(trifluoromethyl)piperidin-4-yl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1CCNC[C@H]1C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C15H19F3N2O2/c16-15(17,18)13-9-19-7-6-12(13)8-20-14(21)22-10-11-4-2-1-3-5-11/h1-5,12-13,19H,6-10H2,(H,20,21)/t12-,13-/m1/s1 |
| InChIKey | GSKKUDWXZVWAMK-CHWSQXEVSA-N |
| XLogP | 2.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |