C12H15F2N — CID 84678460
3-benzyl-4,4-difluoropiperidine (PubChem CID 84678460) has the molecular formula C12H15F2N and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-benzyl-4,4-difluoropiperidine.
| Compound Name | 3-benzyl-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 84678460 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-benzyl-4,4-difluoropiperidine |
| SMILES | FC1(F)CCNCC1Cc1ccccc1 |
| InChI | InChI=1S/C12H15F2N/c13-12(14)6-7-15-9-11(12)8-10-4-2-1-3-5-10/h1-5,11,15H,6-9H2 |
| InChIKey | QIFANDQZDGKFRQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |