About 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane
5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane (PubChem CID 79320491) has the molecular formula C19H29N
and a molecular weight of 271.45 g/mol. Its IUPAC name is 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane |
| PubChem CID | 79320491 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane |
| SMILES | CC1CCCC2(CCNCC2Cc2ccccc2)C1C |
| InChI | InChI=1S/C19H29N/c1-15-7-6-10-19(16(15)2)11-12-20-14-18(19)13-17-8-4-3-5-9-17/h3-5,8-9,15-16,18,20H,6-7,10-14H2,1-2H3 |
| InChIKey | AXKZRHBOIXFBFK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane?
The IUPAC name of 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane (CID 79320491) is 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane.
What is the SMILES notation for 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane?
The canonical SMILES for 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane is CC1CCCC2(CCNCC2Cc2ccccc2)C1C.
What is the InChIKey of 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane?
The InChIKey is AXKZRHBOIXFBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N/c1-15-7-6-10-19(16(15)2)11-12-20-14-18(19)13-17-8-4-3-5-9-17/h3-5,8-9,15-16,18,20H,6-7,10-14H2,1-2H3.
What are the key properties of 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane?
5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane has a molecular weight of 271.45 g/mol, XLogP of 4.28, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-10,11-dimethyl-3-azaspiro[5.5]undecane is sourced from PubChem (CID 79320491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).