C19H19F3N2O2 — CID 70324406
benzyl N-[(4R)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 70324406) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is benzyl N-[(4R)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(4R)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 70324406 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | benzyl N-[(4R)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | O=C(NC1CNCC[C@@H]1c1cc(F)c(F)cc1F)OCc1ccccc1 |
| InChI | InChI=1S/C19H19F3N2O2/c20-15-9-17(22)16(21)8-14(15)13-6-7-23-10-18(13)24-19(25)26-11-12-4-2-1-3-5-12/h1-5,8-9,13,18,23H,6-7,10-11H2,(H,24,25)/t13-,18?/m1/s1 |
| InChIKey | HBBAVYDBJCCJHT-YJJYDOSJSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|