C31H38N2O5 — CID 174609199
benzyl N-[4-(3-phenylmethoxyphenyl)piperidin-3-yl]carbamate;tert-butyl formate (PubChem CID 174609199) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is benzyl N-[4-(3-phenylmethoxyphenyl)piperidin-3-yl]carbamate;tert-butyl formate.
| Compound Name | benzyl N-[4-(3-phenylmethoxyphenyl)piperidin-3-yl]carbamate;tert-butyl formate |
|---|---|
| PubChem CID | 174609199 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | benzyl N-[4-(3-phenylmethoxyphenyl)piperidin-3-yl]carbamate;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=C(NC1CNCCC1c1cccc(OCc2ccccc2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O3.C5H10O2/c29-26(31-19-21-10-5-2-6-11-21)28-25-17-27-15-14-24(25)22-12-7-13-23(16-22)30-18-20-8-3-1-4-9-20;1-5(2,3)7-4-6/h1-13,16,24-25,27H,14-15,17-19H2,(H,28,29);4H,1-3H3 |
| InChIKey | GMVPDEUCMJEDRU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|