C20H28N2O6 — CID 87623364
[(1S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)cyclohexyl] formate (PubChem CID 87623364) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(1S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)cyclohexyl] formate.
| Compound Name | [(1S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)cyclohexyl] formate |
|---|---|
| PubChem CID | 87623364 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [(1S,3R,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)cyclohexyl] formate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](OC=O)CC[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O6/c1-20(2,3)28-19(25)22-17-11-15(27-13-23)9-10-16(17)21-18(24)26-12-14-7-5-4-6-8-14/h4-8,13,15-17H,9-12H2,1-3H3,(H,21,24)(H,22,25)/t15-,16-,17+/m0/s1 |
| InChIKey | NXJUYRLENAUYDT-YESZJQIVSA-N |
| XLogP | 2.90 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|