C18H26N2O5 — CID 134454025
benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-3-yl]carbamate (PubChem CID 134454025) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-3-yl]carbamate.
| Compound Name | benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 134454025 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCOCC1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O5/c1-18(2,3)25-17(22)19-14-9-10-23-12-15(14)20-16(21)24-11-13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,19,22)(H,20,21)/t14-,15?/m1/s1 |
| InChIKey | YTSILEYCFPNBJI-GICMACPYSA-N |
| XLogP | 2.60 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |