C13H17NO4 — CID 131219269
benzyl N-(1,4-dioxepan-6-yl)carbamate (PubChem CID 131219269) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is benzyl N-(1,4-dioxepan-6-yl)carbamate.
| Compound Name | benzyl N-(1,4-dioxepan-6-yl)carbamate |
|---|---|
| PubChem CID | 131219269 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | benzyl N-(1,4-dioxepan-6-yl)carbamate |
| SMILES | O=C(NC1COCCOC1)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c15-13(14-12-9-16-6-7-17-10-12)18-8-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,14,15) |
| InChIKey | CALDGRDYKXAXCP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |