C12H14BrNO3 — CID 86730957
benzyl N-[(2S,3R)-2-(bromomethyl)oxetan-3-yl]carbamate (PubChem CID 86730957) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-2-(bromomethyl)oxetan-3-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-2-(bromomethyl)oxetan-3-yl]carbamate |
|---|---|
| PubChem CID | 86730957 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | benzyl N-[(2S,3R)-2-(bromomethyl)oxetan-3-yl]carbamate |
| SMILES | O=C(N[C@@H]1CO[C@@H]1CBr)OCc1ccccc1 |
| InChI | InChI=1S/C12H14BrNO3/c13-6-11-10(8-16-11)14-12(15)17-7-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | USAJJBDGRQEAMK-GHMZBOCLSA-N |
| XLogP | 2.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|