C12H16ClNO4 — CID 133063697
benzyl N-(4-hydroxyoxolan-3-yl)carbamate;hydrochloride (PubChem CID 133063697) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is benzyl N-(4-hydroxyoxolan-3-yl)carbamate;hydrochloride.
| Compound Name | benzyl N-(4-hydroxyoxolan-3-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 133063697 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | benzyl N-(4-hydroxyoxolan-3-yl)carbamate;hydrochloride |
| SMILES | Cl.O=C(NC1COCC1O)OCc1ccccc1 |
| InChI | InChI=1S/C12H15NO4.ClH/c14-11-8-16-7-10(11)13-12(15)17-6-9-4-2-1-3-5-9;/h1-5,10-11,14H,6-8H2,(H,13,15);1H |
| InChIKey | JMEYUEPZGWZNQL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |