C22H35N3O5 — CID 174578765
benzyl N-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]carbamate;tert-butyl formate (PubChem CID 174578765) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]carbamate;tert-butyl formate.
| Compound Name | benzyl N-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]carbamate;tert-butyl formate |
|---|---|
| PubChem CID | 174578765 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | benzyl N-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]carbamate;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=C(CNC(=O)OCc1ccccc1)NCCC1CCNCC1 |
| InChI | InChI=1S/C17H25N3O3.C5H10O2/c21-16(19-11-8-14-6-9-18-10-7-14)12-20-17(22)23-13-15-4-2-1-3-5-15;1-5(2,3)7-4-6/h1-5,14,18H,6-13H2,(H,19,21)(H,20,22);4H,1-3H3 |
| InChIKey | VSPKQPUZXGXSAQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|