C19H28N2O4 — CID 124845856
benzyl N-[2-[[(2S)-2-cyclohexyl-2-hydroxypropyl]amino]-2-oxoethyl]carbamate (PubChem CID 124845856) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-2-cyclohexyl-2-hydroxypropyl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-2-cyclohexyl-2-hydroxypropyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 124845856 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | benzyl N-[2-[[(2S)-2-cyclohexyl-2-hydroxypropyl]amino]-2-oxoethyl]carbamate |
| SMILES | C[C@@](O)(CNC(=O)CNC(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H28N2O4/c1-19(24,16-10-6-3-7-11-16)14-21-17(22)12-20-18(23)25-13-15-8-4-2-5-9-15/h2,4-5,8-9,16,24H,3,6-7,10-14H2,1H3,(H,20,23)(H,21,22)/t19-/m1/s1 |
| InChIKey | HVKVKACNEIXNSQ-LJQANCHMSA-N |
| XLogP | 2.36 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |