C16H22N2O5 — CID 13338812
benzyl N-[2-[(2,6-dihydroxycyclohexyl)amino]-2-oxoethyl]carbamate (PubChem CID 13338812) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is benzyl N-[2-[(2,6-dihydroxycyclohexyl)amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[(2,6-dihydroxycyclohexyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 13338812 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | benzyl N-[2-[(2,6-dihydroxycyclohexyl)amino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NC1C(O)CCCC1O |
| InChI | InChI=1S/C16H22N2O5/c19-12-7-4-8-13(20)15(12)18-14(21)9-17-16(22)23-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,15,19-20H,4,7-10H2,(H,17,22)(H,18,21) |
| InChIKey | HFRBBNMCCCWWMJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |