C29H24F4N4O2 — CID 86761274
benzyl N-[(3R,4R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 86761274) has the molecular formula C29H24F4N4O2 and a molecular weight of 536.53 g/mol. Its IUPAC name is benzyl N-[(3R,4R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3R,4R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86761274 |
| Molecular Formula | C29H24F4N4O2 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | benzyl N-[(3R,4R)-1-[6-(4-fluorophenyl)pyridazin-3-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | O=C(N[C@H]1CN(c2ccc(-c3ccc(F)cc3)nn2)CC[C@@H]1c1cc(F)c(F)cc1F)OCc1ccccc1 |
| InChI | InChI=1S/C29H24F4N4O2/c30-20-8-6-19(7-9-20)26-10-11-28(36-35-26)37-13-12-21(22-14-24(32)25(33)15-23(22)31)27(16-37)34-29(38)39-17-18-4-2-1-3-5-18/h1-11,14-15,21,27H,12-13,16-17H2,(H,34,38)/t21-,27+/m1/s1 |
| InChIKey | LDCANBSKJJMQCG-ZBLYBZFDSA-N |
| XLogP | 5.99 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|